C18H20N2O7S2 — CID 6534264
2-methylpropyl 2-[(5Z)-5-[[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 6534264) has the molecular formula C18H20N2O7S2 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-methylpropyl 2-[(5Z)-5-[[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-methylpropyl 2-[(5Z)-5-[[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 6534264 |
| Molecular Formula | C18H20N2O7S2 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 2-methylpropyl 2-[(5Z)-5-[[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC(C)COC(=O)CN1C(=O)S/C(=C\c2ccc(SCCO)c([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C18H20N2O7S2/c1-11(2)10-27-16(22)9-19-17(23)15(29-18(19)24)8-12-3-4-14(28-6-5-21)13(7-12)20(25)26/h3-4,7-8,11,21H,5-6,9-10H2,1-2H3/b15-8- |
| InChIKey | NEQHTEDHZAIDGG-NVNXTCNLSA-N |
| XLogP | 2.91 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|