C19H15BrN2O5S2 — CID 4099030
3-[(3-bromophenyl)methyl]-5-[[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 4099030) has the molecular formula C19H15BrN2O5S2 and a molecular weight of 495.38 g/mol. Its IUPAC name is 3-[(3-bromophenyl)methyl]-5-[[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(3-bromophenyl)methyl]-5-[[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4099030 |
| Molecular Formula | C19H15BrN2O5S2 |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 493.96 |
| IUPAC Name | 3-[(3-bromophenyl)methyl]-5-[[4-(2-hydroxyethylsulfanyl)-3-nitrophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc(SCCO)c([N+](=O)[O-])c2)C(=O)N1Cc1cccc(Br)c1 |
| InChI | InChI=1S/C19H15BrN2O5S2/c20-14-3-1-2-13(8-14)11-21-18(24)17(29-19(21)25)10-12-4-5-16(28-7-6-23)15(9-12)22(26)27/h1-5,8-10,23H,6-7,11H2 |
| InChIKey | AZMZULBDQOUCQG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|