C17H11BrClNO2S — CID 126158947
(5E)-3-[(3-bromophenyl)methyl]-5-[(3-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126158947) has the molecular formula C17H11BrClNO2S and a molecular weight of 408.70 g/mol. Its IUPAC name is (5E)-3-[(3-bromophenyl)methyl]-5-[(3-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(3-bromophenyl)methyl]-5-[(3-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126158947 |
| Molecular Formula | C17H11BrClNO2S |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 406.94 |
| IUPAC Name | (5E)-3-[(3-bromophenyl)methyl]-5-[(3-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2cccc(Cl)c2)C(=O)N1Cc1cccc(Br)c1 |
| InChI | InChI=1S/C17H11BrClNO2S/c18-13-5-1-4-12(7-13)10-20-16(21)15(23-17(20)22)9-11-3-2-6-14(19)8-11/h1-9H,10H2/b15-9+ |
| InChIKey | FYIIEBQQASOPRZ-OQLLNIDSSA-N |
| XLogP | 5.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|