C19H16Br2N2O2S — CID 126365843
(5Z)-5-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-3-[(3-bromophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126365843) has the molecular formula C19H16Br2N2O2S and a molecular weight of 496.22 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-3-[(3-bromophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-3-[(3-bromophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126365843 |
| Molecular Formula | C19H16Br2N2O2S |
| Molecular Weight | 496.22 g/mol |
| Exact Mass | 493.93 |
| IUPAC Name | (5Z)-5-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-3-[(3-bromophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(C)c1ccc(/C=C2\SC(=O)N(Cc3cccc(Br)c3)C2=O)cc1Br |
| InChI | InChI=1S/C19H16Br2N2O2S/c1-22(2)16-7-6-12(9-15(16)21)10-17-18(24)23(19(25)26-17)11-13-4-3-5-14(20)8-13/h3-10H,11H2,1-2H3/b17-10- |
| InChIKey | QKDOUJLXPBUKKA-YVLHZVERSA-N |
| XLogP | 5.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.22 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|