C14H11BrN2O7S — CID 22779389
ethyl 2-[(5Z)-5-[(3-bromo-4-hydroxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 22779389) has the molecular formula C14H11BrN2O7S and a molecular weight of 431.22 g/mol. Its IUPAC name is ethyl 2-[(5Z)-5-[(3-bromo-4-hydroxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(5Z)-5-[(3-bromo-4-hydroxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 22779389 |
| Molecular Formula | C14H11BrN2O7S |
| Molecular Weight | 431.22 g/mol |
| Exact Mass | 429.95 |
| IUPAC Name | ethyl 2-[(5Z)-5-[(3-bromo-4-hydroxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)S/C(=C\c2cc(Br)c(O)c([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C14H11BrN2O7S/c1-2-24-11(18)6-16-13(20)10(25-14(16)21)5-7-3-8(15)12(19)9(4-7)17(22)23/h3-5,19H,2,6H2,1H3/b10-5- |
| InChIKey | OVYDELGGQGIXNU-YHYXMXQVSA-N |
| XLogP | 2.66 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|