C28H19ClF3N3O4S — CID 86659703
methyl 3-[[(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate (PubChem CID 86659703) has the molecular formula C28H19ClF3N3O4S and a molecular weight of 585.99 g/mol. Its IUPAC name is methyl 3-[[(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate.
| Compound Name | methyl 3-[[(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 86659703 |
| Molecular Formula | C28H19ClF3N3O4S |
| Molecular Weight | 585.99 g/mol |
| Exact Mass | 585.07 |
| IUPAC Name | methyl 3-[[(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CN2C(=O)S/C(=C\c3ccc4c(cnn4Cc4ccc(Cl)cc4C(F)(F)F)c3)C2=O)c1 |
| InChI | InChI=1S/C28H19ClF3N3O4S/c1-39-26(37)18-4-2-3-17(10-18)14-34-25(36)24(40-27(34)38)11-16-5-8-23-20(9-16)13-33-35(23)15-19-6-7-21(29)12-22(19)28(30,31)32/h2-13H,14-15H2,1H3/b24-11- |
| InChIKey | KAGVHCIHIZHZTL-MYKKPKGFSA-N |
| XLogP | 6.78 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.99 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|