C28H26F6N6O2S — CID 53356016
2-[4-[[(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]-methylamino]piperidin-1-yl]acetamide (PubChem CID 53356016) has the molecular formula C28H26F6N6O2S and a molecular weight of 624.61 g/mol. Its IUPAC name is 2-[4-[[(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]-methylamino]piperidin-1-yl]acetamide.
| Compound Name | 2-[4-[[(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]-methylamino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 53356016 |
| Molecular Formula | C28H26F6N6O2S |
| Molecular Weight | 624.61 g/mol |
| Exact Mass | 624.17 |
| IUPAC Name | 2-[4-[[(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]-methylamino]piperidin-1-yl]acetamide |
| SMILES | CN(C1=NC(=O)/C(=C/c2ccc3c(cnn3Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c2)S1)C1CCN(CC(N)=O)CC1 |
| InChI | InChI=1S/C28H26F6N6O2S/c1-38(20-6-8-39(9-7-20)15-24(35)41)26-37-25(42)23(43-26)11-16-2-5-22-18(10-16)13-36-40(22)14-17-3-4-19(27(29,30)31)12-21(17)28(32,33)34/h2-5,10-13,20H,6-9,14-15H2,1H3,(H2,35,41)/b23-11- |
| InChIKey | JLRDRPIXJPWREE-KSEXSDGBSA-N |
| XLogP | 4.97 |
| TPSA | 96.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|