C24H19F3N4O3S — CID 58311698
(2S)-1-[(5Z)-5-[[1-[[4-methyl-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]azetidine-2-carboxylic acid (PubChem CID 58311698) has the molecular formula C24H19F3N4O3S and a molecular weight of 500.50 g/mol. Its IUPAC name is (2S)-1-[(5Z)-5-[[1-[[4-methyl-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]azetidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(5Z)-5-[[1-[[4-methyl-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]azetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 58311698 |
| Molecular Formula | C24H19F3N4O3S |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | (2S)-1-[(5Z)-5-[[1-[[4-methyl-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]azetidine-2-carboxylic acid |
| SMILES | Cc1ccc(Cn2ncc3cc(/C=C4\SC(N5CC[C@H]5C(=O)O)=NC4=O)ccc32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H19F3N4O3S/c1-13-2-4-15(17(8-13)24(25,26)27)12-31-18-5-3-14(9-16(18)11-28-31)10-20-21(32)29-23(35-20)30-7-6-19(30)22(33)34/h2-5,8-11,19H,6-7,12H2,1H3,(H,33,34)/b20-10-/t19-/m0/s1 |
| InChIKey | TYBXZSPURVAFFP-LVWFPGDPSA-N |
| XLogP | 4.54 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|