C14H13FN2O3S — CID 143842517
(5Z)-5-[(5-fluoro-2-hydroxyphenyl)methylidene]-2-(3-hydroxypyrrolidin-1-yl)-1,3-thiazol-4-one (PubChem CID 143842517) has the molecular formula C14H13FN2O3S and a molecular weight of 308.33 g/mol. Its IUPAC name is (5Z)-5-[(5-fluoro-2-hydroxyphenyl)methylidene]-2-(3-hydroxypyrrolidin-1-yl)-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[(5-fluoro-2-hydroxyphenyl)methylidene]-2-(3-hydroxypyrrolidin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 143842517 |
| Molecular Formula | C14H13FN2O3S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | (5Z)-5-[(5-fluoro-2-hydroxyphenyl)methylidene]-2-(3-hydroxypyrrolidin-1-yl)-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCC(O)C2)S/C1=C\c1cc(F)ccc1O |
| InChI | InChI=1S/C14H13FN2O3S/c15-9-1-2-11(19)8(5-9)6-12-13(20)16-14(21-12)17-4-3-10(18)7-17/h1-2,5-6,10,18-19H,3-4,7H2/b12-6- |
| InChIKey | FABVETZKIKFOGI-SDQBBNPISA-N |
| XLogP | 1.57 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|