C19H22FN3O4S — CID 143842334
tert-butyl N-[1-[(5Z)-5-[(5-fluoro-2-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]pyrrolidin-3-yl]carbamate (PubChem CID 143842334) has the molecular formula C19H22FN3O4S and a molecular weight of 407.47 g/mol. Its IUPAC name is tert-butyl N-[1-[(5Z)-5-[(5-fluoro-2-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(5Z)-5-[(5-fluoro-2-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 143842334 |
| Molecular Formula | C19H22FN3O4S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | tert-butyl N-[1-[(5Z)-5-[(5-fluoro-2-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C2=NC(=O)/C(=C/c3cc(F)ccc3O)S2)C1 |
| InChI | InChI=1S/C19H22FN3O4S/c1-19(2,3)27-18(26)21-13-6-7-23(10-13)17-22-16(25)15(28-17)9-11-8-12(20)4-5-14(11)24/h4-5,8-9,13,24H,6-7,10H2,1-3H3,(H,21,26)/b15-9- |
| InChIKey | AIQFTFAJSOZSMO-DHDCSXOGSA-N |
| XLogP | 3.10 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|