C19H24FN3O2S — CID 143842439
(5Z)-2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-5-[(4-fluoro-2-hydroxyphenyl)methylidene]-1,3-thiazol-4-one;ethane (PubChem CID 143842439) has the molecular formula C19H24FN3O2S and a molecular weight of 377.49 g/mol. Its IUPAC name is (5Z)-2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-5-[(4-fluoro-2-hydroxyphenyl)methylidene]-1,3-thiazol-4-one;ethane.
| Compound Name | (5Z)-2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-5-[(4-fluoro-2-hydroxyphenyl)methylidene]-1,3-thiazol-4-one;ethane |
|---|---|
| PubChem CID | 143842439 |
| Molecular Formula | C19H24FN3O2S |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (5Z)-2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-5-[(4-fluoro-2-hydroxyphenyl)methylidene]-1,3-thiazol-4-one;ethane |
| SMILES | CC.O=C1N=C(N2CCN3CCCC3C2)S/C1=C\c1ccc(F)cc1O |
| InChI | InChI=1S/C17H18FN3O2S.C2H6/c18-12-4-3-11(14(22)9-12)8-15-16(23)19-17(24-15)21-7-6-20-5-1-2-13(20)10-21;1-2/h3-4,8-9,13,22H,1-2,5-7,10H2;1-2H3/b15-8-; |
| InChIKey | YGAZGEQOPMWNDW-ZTXYIFKNSA-N |
| XLogP | 3.31 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|