C21H20FN3O2S — CID 17129561
(5E)-2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-5-[(2-hydroxyphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 17129561) has the molecular formula C21H20FN3O2S and a molecular weight of 397.48 g/mol. Its IUPAC name is (5E)-2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-5-[(2-hydroxyphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5E)-2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-5-[(2-hydroxyphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 17129561 |
| Molecular Formula | C21H20FN3O2S |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (5E)-2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-5-[(2-hydroxyphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCN(Cc3ccc(F)cc3)CC2)S/C1=C/c1ccccc1O |
| InChI | InChI=1S/C21H20FN3O2S/c22-17-7-5-15(6-8-17)14-24-9-11-25(12-10-24)21-23-20(27)19(28-21)13-16-3-1-2-4-18(16)26/h1-8,13,26H,9-12,14H2/b19-13+ |
| InChIKey | YKJBTPWSBZQKBZ-CPNJWEJPSA-N |
| XLogP | 3.32 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|