C18H20FN3O2S — CID 70951054
(5Z)-2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-5-[(5-fluoro-2-hydroxy-3-methylphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 70951054) has the molecular formula C18H20FN3O2S and a molecular weight of 361.44 g/mol. Its IUPAC name is (5Z)-2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-5-[(5-fluoro-2-hydroxy-3-methylphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-5-[(5-fluoro-2-hydroxy-3-methylphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 70951054 |
| Molecular Formula | C18H20FN3O2S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (5Z)-2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-5-[(5-fluoro-2-hydroxy-3-methylphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | Cc1cc(F)cc(/C=C2\SC(N3CCN4CCC[C@H]4C3)=NC2=O)c1O |
| InChI | InChI=1S/C18H20FN3O2S/c1-11-7-13(19)8-12(16(11)23)9-15-17(24)20-18(25-15)22-6-5-21-4-2-3-14(21)10-22/h7-9,14,23H,2-6,10H2,1H3/b15-9-/t14-/m0/s1 |
| InChIKey | WJDKSDXMJNLMNN-BUYRESAOSA-N |
| XLogP | 2.59 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|