C16H18FN3O2S — CID 70954076
(4E)-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-4-[(5-fluoro-2-hydroxyphenyl)methylidene]-1,3-thiazol-5-one (PubChem CID 70954076) has the molecular formula C16H18FN3O2S and a molecular weight of 335.40 g/mol. Its IUPAC name is (4E)-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-4-[(5-fluoro-2-hydroxyphenyl)methylidene]-1,3-thiazol-5-one.
| Compound Name | (4E)-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-4-[(5-fluoro-2-hydroxyphenyl)methylidene]-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 70954076 |
| Molecular Formula | C16H18FN3O2S |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (4E)-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-4-[(5-fluoro-2-hydroxyphenyl)methylidene]-1,3-thiazol-5-one |
| SMILES | CN(C)[C@@H]1CCN(C2=N/C(=C/c3cc(F)ccc3O)C(=O)S2)C1 |
| InChI | InChI=1S/C16H18FN3O2S/c1-19(2)12-5-6-20(9-12)16-18-13(15(22)23-16)8-10-7-11(17)3-4-14(10)21/h3-4,7-8,12,21H,5-6,9H2,1-2H3/b13-8+/t12-/m1/s1 |
| InChIKey | YACLKNMGGPYAFL-FMNNIJNLSA-N |
| XLogP | 2.14 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|