C23H22N4O4S — CID 2905144
2-[4-(2-nitrophenyl)piperazin-1-yl]-5-[(2-prop-2-enoxyphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 2905144) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is 2-[4-(2-nitrophenyl)piperazin-1-yl]-5-[(2-prop-2-enoxyphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-[4-(2-nitrophenyl)piperazin-1-yl]-5-[(2-prop-2-enoxyphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 2905144 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 2-[4-(2-nitrophenyl)piperazin-1-yl]-5-[(2-prop-2-enoxyphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | C=CCOc1ccccc1C=C1SC(N2CCN(c3ccccc3[N+](=O)[O-])CC2)=NC1=O |
| InChI | InChI=1S/C23H22N4O4S/c1-2-15-31-20-10-6-3-7-17(20)16-21-22(28)24-23(32-21)26-13-11-25(12-14-26)18-8-4-5-9-19(18)27(29)30/h2-10,16H,1,11-15H2 |
| InChIKey | DPXUMZZGGCPPKY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|