C17H15N3O2S — CID 11976459
(5E)-2-morpholin-4-yl-5-(quinolin-3-ylmethylidene)-1,3-thiazol-4-one (PubChem CID 11976459) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is (5E)-2-morpholin-4-yl-5-(quinolin-3-ylmethylidene)-1,3-thiazol-4-one.
| Compound Name | (5E)-2-morpholin-4-yl-5-(quinolin-3-ylmethylidene)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 11976459 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (5E)-2-morpholin-4-yl-5-(quinolin-3-ylmethylidene)-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCOCC2)S/C1=C/c1cnc2ccccc2c1 |
| InChI | InChI=1S/C17H15N3O2S/c21-16-15(23-17(19-16)20-5-7-22-8-6-20)10-12-9-13-3-1-2-4-14(13)18-11-12/h1-4,9-11H,5-8H2/b15-10+ |
| InChIKey | SHMWPJZVMWXMNC-XNTDXEJSSA-N |
| XLogP | 2.54 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|