C15H17N3O2S — CID 7346432
(5E)-2-amino-5-[(3-methyl-4-morpholin-4-ylphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 7346432) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is (5E)-2-amino-5-[(3-methyl-4-morpholin-4-ylphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5E)-2-amino-5-[(3-methyl-4-morpholin-4-ylphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 7346432 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (5E)-2-amino-5-[(3-methyl-4-morpholin-4-ylphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | Cc1cc(/C=C2/SC(N)=NC2=O)ccc1N1CCOCC1 |
| InChI | InChI=1S/C15H17N3O2S/c1-10-8-11(9-13-14(19)17-15(16)21-13)2-3-12(10)18-4-6-20-7-5-18/h2-3,8-9H,4-7H2,1H3,(H2,16,17,19)/b13-9+ |
| InChIKey | IRLJZKQAJXYSFS-UKTHLTGXSA-N |
| XLogP | 1.76 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|