C11H10N2OS — CID 2828980
2-amino-5-[(4-methylphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 2828980) has the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. Its IUPAC name is 2-amino-5-[(4-methylphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-amino-5-[(4-methylphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 2828980 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 2-amino-5-[(4-methylphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | Cc1ccc(C=C2SC(N)=NC2=O)cc1 |
| InChI | InChI=1S/C11H10N2OS/c1-7-2-4-8(5-3-7)6-9-10(14)13-11(12)15-9/h2-6H,1H3,(H2,12,13,14) |
| InChIKey | VMIJJMVEQOFALP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|