C11H7N2O3S- — CID 2052605
4-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]benzoate (PubChem CID 2052605) has the molecular formula C11H7N2O3S- and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]benzoate.
| Compound Name | 4-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]benzoate |
|---|---|
| PubChem CID | 2052605 |
| Molecular Formula | C11H7N2O3S- |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 4-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]benzoate |
| SMILES | NC1=NC(=O)/C(=C/c2ccc(C(=O)[O-])cc2)S1 |
| InChI | InChI=1S/C11H8N2O3S/c12-11-13-9(14)8(17-11)5-6-1-3-7(4-2-6)10(15)16/h1-5H,(H,15,16)(H2,12,13,14)/p-1/b8-5- |
| InChIKey | XAAJPLDVJNMAIC-YVMONPNESA-M |
| XLogP | -0.02 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|