C17H12N2O3S — CID 1232677
[4-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] benzoate (PubChem CID 1232677) has the molecular formula C17H12N2O3S and a molecular weight of 324.36 g/mol. Its IUPAC name is [4-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] benzoate.
| Compound Name | [4-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 1232677 |
| Molecular Formula | C17H12N2O3S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | [4-[(E)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] benzoate |
| SMILES | NC1=NC(=O)/C(=C\c2ccc(OC(=O)c3ccccc3)cc2)S1 |
| InChI | InChI=1S/C17H12N2O3S/c18-17-19-15(20)14(23-17)10-11-6-8-13(9-7-11)22-16(21)12-4-2-1-3-5-12/h1-10H,(H2,18,19,20)/b14-10+ |
| InChIKey | ODSKKNZBNFPNON-GXDHUFHOSA-N |
| XLogP | 2.83 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|