C28H25N3O3S — CID 3819239
[4-[[2-[4-(4-methylphenyl)piperazin-1-yl]-4-oxo-1,3-thiazol-5-ylidene]methyl]phenyl] benzoate (PubChem CID 3819239) has the molecular formula C28H25N3O3S and a molecular weight of 483.59 g/mol. Its IUPAC name is [4-[[2-[4-(4-methylphenyl)piperazin-1-yl]-4-oxo-1,3-thiazol-5-ylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[[2-[4-(4-methylphenyl)piperazin-1-yl]-4-oxo-1,3-thiazol-5-ylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 3819239 |
| Molecular Formula | C28H25N3O3S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | [4-[[2-[4-(4-methylphenyl)piperazin-1-yl]-4-oxo-1,3-thiazol-5-ylidene]methyl]phenyl] benzoate |
| SMILES | Cc1ccc(N2CCN(C3=NC(=O)C(=Cc4ccc(OC(=O)c5ccccc5)cc4)S3)CC2)cc1 |
| InChI | InChI=1S/C28H25N3O3S/c1-20-7-11-23(12-8-20)30-15-17-31(18-16-30)28-29-26(32)25(35-28)19-21-9-13-24(14-10-21)34-27(33)22-5-3-2-4-6-22/h2-14,19H,15-18H2,1H3 |
| InChIKey | LYDQJVSCOWFICV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|