C21H17BrN2O4S — CID 2904773
[4-[(2-morpholin-4-yl-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-bromobenzoate (PubChem CID 2904773) has the molecular formula C21H17BrN2O4S and a molecular weight of 473.35 g/mol. Its IUPAC name is [4-[(2-morpholin-4-yl-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[(2-morpholin-4-yl-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 2904773 |
| Molecular Formula | C21H17BrN2O4S |
| Molecular Weight | 473.35 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | [4-[(2-morpholin-4-yl-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] 4-bromobenzoate |
| SMILES | O=C1N=C(N2CCOCC2)SC1=Cc1ccc(OC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C21H17BrN2O4S/c22-16-5-3-15(4-6-16)20(26)28-17-7-1-14(2-8-17)13-18-19(25)23-21(29-18)24-9-11-27-12-10-24/h1-8,13H,9-12H2 |
| InChIKey | TUEZYLBQIKJPNP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|