C22H22N4O2S — CID 71950890
N-[4-[[4-oxo-2-(4-phenylpiperazin-1-yl)-1,3-thiazol-5-ylidene]methyl]phenyl]acetamide (PubChem CID 71950890) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is N-[4-[[4-oxo-2-(4-phenylpiperazin-1-yl)-1,3-thiazol-5-ylidene]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-oxo-2-(4-phenylpiperazin-1-yl)-1,3-thiazol-5-ylidene]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 71950890 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[4-[[4-oxo-2-(4-phenylpiperazin-1-yl)-1,3-thiazol-5-ylidene]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C=C2SC(N3CCN(c4ccccc4)CC3)=NC2=O)cc1 |
| InChI | InChI=1S/C22H22N4O2S/c1-16(27)23-18-9-7-17(8-10-18)15-20-21(28)24-22(29-20)26-13-11-25(12-14-26)19-5-3-2-4-6-19/h2-10,15H,11-14H2,1H3,(H,23,27) |
| InChIKey | PNUHCMTUFMTRIA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|