C12H10N2O2S — CID 696268
N-(5-benzylidene-4-oxo-1,3-thiazol-2-yl)acetamide (PubChem CID 696268) has the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. Its IUPAC name is N-(5-benzylidene-4-oxo-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-(5-benzylidene-4-oxo-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 696268 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | N-(5-benzylidene-4-oxo-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(=O)NC1=NC(=O)C(=Cc2ccccc2)S1 |
| InChI | InChI=1S/C12H10N2O2S/c1-8(15)13-12-14-11(16)10(17-12)7-9-5-3-2-4-6-9/h2-7H,1H3,(H,13,14,15,16) |
| InChIKey | QMKPYQOFBUYLQJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|