C11H9NOS — CID 86629114
5-benzylidene-2-methyl-1,3-thiazol-4-one (PubChem CID 86629114) has the molecular formula C11H9NOS and a molecular weight of 203.27 g/mol. Its IUPAC name is 5-benzylidene-2-methyl-1,3-thiazol-4-one.
| Compound Name | 5-benzylidene-2-methyl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 86629114 |
| Molecular Formula | C11H9NOS |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 5-benzylidene-2-methyl-1,3-thiazol-4-one |
| SMILES | CC1=NC(=O)C(=Cc2ccccc2)S1 |
| InChI | InChI=1S/C11H9NOS/c1-8-12-11(13)10(14-8)7-9-5-3-2-4-6-9/h2-7H,1H3 |
| InChIKey | RAZGFSOKOUIOHP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|