C34H25N3OS — CID 58795339
(5E)-2-(N-phenylanilino)-5-[[4-(N-phenylanilino)phenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 58795339) has the molecular formula C34H25N3OS and a molecular weight of 523.66 g/mol. Its IUPAC name is (5E)-2-(N-phenylanilino)-5-[[4-(N-phenylanilino)phenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5E)-2-(N-phenylanilino)-5-[[4-(N-phenylanilino)phenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58795339 |
| Molecular Formula | C34H25N3OS |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | (5E)-2-(N-phenylanilino)-5-[[4-(N-phenylanilino)phenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N(c2ccccc2)c2ccccc2)S/C1=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H25N3OS/c38-33-32(39-34(35-33)37(29-17-9-3-10-18-29)30-19-11-4-12-20-30)25-26-21-23-31(24-22-26)36(27-13-5-1-6-14-27)28-15-7-2-8-16-28/h1-25H/b32-25+ |
| InChIKey | CLAFKOMKELCZIJ-WGPBWIAQSA-N |
| XLogP | 8.97 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|