C25H22N2O4S — CID 58795362
(5E)-2-(N-phenylanilino)-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 58795362) has the molecular formula C25H22N2O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is (5E)-2-(N-phenylanilino)-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5E)-2-(N-phenylanilino)-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58795362 |
| Molecular Formula | C25H22N2O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | (5E)-2-(N-phenylanilino)-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | COc1cc(/C=C2/SC(N(c3ccccc3)c3ccccc3)=NC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C25H22N2O4S/c1-29-20-14-17(15-21(30-2)23(20)31-3)16-22-24(28)26-25(32-22)27(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-16H,1-3H3/b22-16+ |
| InChIKey | MFLPDTXUTXZMLB-CJLVFECKSA-N |
| XLogP | 5.52 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|