C33H23N2NaO2S — CID 87711215
sodium (5Z)-2-(N-phenylanilino)-5-[(6-phenylmethoxynaphthalen-2-yl)methylidene]-1,3-thiazol-4-one (PubChem CID 87711215) has the molecular formula C33H23N2NaO2S and a molecular weight of 534.62 g/mol. Its IUPAC name is sodium (5Z)-2-(N-phenylanilino)-5-[(6-phenylmethoxynaphthalen-2-yl)methylidene]-1,3-thiazol-4-one.
| Compound Name | sodium (5Z)-2-(N-phenylanilino)-5-[(6-phenylmethoxynaphthalen-2-yl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 87711215 |
| Molecular Formula | C33H23N2NaO2S |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | sodium (5Z)-2-(N-phenylanilino)-5-[(6-phenylmethoxynaphthalen-2-yl)methylidene]-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N(c2cc[c-]cc2)c2ccccc2)S/C1=C\c1ccc2cc(OCc3ccccc3)ccc2c1.[Na+] |
| InChI | InChI=1S/C33H23N2O2S.Na/c36-32-31(38-33(34-32)35(28-12-6-2-7-13-28)29-14-8-3-9-15-29)21-25-16-17-27-22-30(19-18-26(27)20-25)37-23-24-10-4-1-5-11-24;/h1-2,4-22H,23H2;/q-1;+1/b31-21-; |
| InChIKey | PNWLXAQXXUHECC-ITAKFYBTSA-N |
| XLogP | 5.03 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|