C22H17N2OPS2 — CID 89010781
(5E)-5-[[4-(N-phenylanilino)phenyl]methylidene]-3-phosphanyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 89010781) has the molecular formula C22H17N2OPS2 and a molecular weight of 420.50 g/mol. Its IUPAC name is (5E)-5-[[4-(N-phenylanilino)phenyl]methylidene]-3-phosphanyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[4-(N-phenylanilino)phenyl]methylidene]-3-phosphanyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 89010781 |
| Molecular Formula | C22H17N2OPS2 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | (5E)-5-[[4-(N-phenylanilino)phenyl]methylidene]-3-phosphanyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(N(c3ccccc3)c3ccccc3)cc2)SC(=S)N1P |
| InChI | InChI=1S/C22H17N2OPS2/c25-21-20(28-22(27)24(21)26)15-16-11-13-19(14-12-16)23(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-15H,26H2/b20-15+ |
| InChIKey | FFWHBVUURFBMIB-HMMYKYKNSA-N |
| XLogP | 6.15 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|