C10H7IN2O3S — CID 1360683
N-[5-[(5-iodofuran-2-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide (PubChem CID 1360683) has the molecular formula C10H7IN2O3S and a molecular weight of 362.15 g/mol. Its IUPAC name is N-[5-[(5-iodofuran-2-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[(5-iodofuran-2-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 1360683 |
| Molecular Formula | C10H7IN2O3S |
| Molecular Weight | 362.15 g/mol |
| Exact Mass | 361.92 |
| IUPAC Name | N-[5-[(5-iodofuran-2-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)NC1=NC(=O)C(=Cc2ccc(I)o2)S1 |
| InChI | InChI=1S/C10H7IN2O3S/c1-5(14)12-10-13-9(15)7(17-10)4-6-2-3-8(11)16-6/h2-4H,1H3,(H,12,13,14,15) |
| InChIKey | OAOTWUUMIJEKMM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.15 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|