C14H8INO2S — CID 5377235
(5Z)-5-[(5-iodofuran-2-yl)methylidene]-2-phenyl-1,3-thiazol-4-one (PubChem CID 5377235) has the molecular formula C14H8INO2S and a molecular weight of 381.19 g/mol. Its IUPAC name is (5Z)-5-[(5-iodofuran-2-yl)methylidene]-2-phenyl-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[(5-iodofuran-2-yl)methylidene]-2-phenyl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 5377235 |
| Molecular Formula | C14H8INO2S |
| Molecular Weight | 381.19 g/mol |
| Exact Mass | 380.93 |
| IUPAC Name | (5Z)-5-[(5-iodofuran-2-yl)methylidene]-2-phenyl-1,3-thiazol-4-one |
| SMILES | O=C1N=C(c2ccccc2)S/C1=C\c1ccc(I)o1 |
| InChI | InChI=1S/C14H8INO2S/c15-12-7-6-10(18-12)8-11-13(17)16-14(19-11)9-4-2-1-3-5-9/h1-8H/b11-8- |
| InChIKey | YLMKSAKYQDVYAS-FLIBITNWSA-N |
| XLogP | 3.95 |
| TPSA | 42.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.19 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|