C21H14ClNO2S — CID 1352038
5-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-2-(4-methylphenyl)-1,3-thiazol-4-one (PubChem CID 1352038) has the molecular formula C21H14ClNO2S and a molecular weight of 379.87 g/mol. Its IUPAC name is 5-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-2-(4-methylphenyl)-1,3-thiazol-4-one.
| Compound Name | 5-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-2-(4-methylphenyl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 1352038 |
| Molecular Formula | C21H14ClNO2S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 5-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-2-(4-methylphenyl)-1,3-thiazol-4-one |
| SMILES | Cc1ccc(C2=NC(=O)C(=Cc3ccc(-c4ccc(Cl)cc4)o3)S2)cc1 |
| InChI | InChI=1S/C21H14ClNO2S/c1-13-2-4-15(5-3-13)21-23-20(24)19(26-21)12-17-10-11-18(25-17)14-6-8-16(22)9-7-14/h2-12H,1H3 |
| InChIKey | LPGJWJNAWXEBEP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 42.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|