C16H12ClNO2S2 — CID 885675
4-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-2-ethylsulfanyl-1,3-thiazol-5-one (PubChem CID 885675) has the molecular formula C16H12ClNO2S2 and a molecular weight of 349.86 g/mol. Its IUPAC name is 4-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-2-ethylsulfanyl-1,3-thiazol-5-one.
| Compound Name | 4-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-2-ethylsulfanyl-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 885675 |
| Molecular Formula | C16H12ClNO2S2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 4-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-2-ethylsulfanyl-1,3-thiazol-5-one |
| SMILES | CCSC1=NC(=Cc2ccc(-c3ccc(Cl)cc3)o2)C(=O)S1 |
| InChI | InChI=1S/C16H12ClNO2S2/c1-2-21-16-18-13(15(19)22-16)9-12-7-8-14(20-12)10-3-5-11(17)6-4-10/h3-9H,2H2,1H3 |
| InChIKey | FYOVORPNCWBLQD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 42.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|