C19H16ClNO2S2 — CID 2191535
(4E)-4-[[2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-ethylsulfanyl-1,3-thiazol-5-one (PubChem CID 2191535) has the molecular formula C19H16ClNO2S2 and a molecular weight of 389.93 g/mol. Its IUPAC name is (4E)-4-[[2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-ethylsulfanyl-1,3-thiazol-5-one.
| Compound Name | (4E)-4-[[2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-ethylsulfanyl-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 2191535 |
| Molecular Formula | C19H16ClNO2S2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | (4E)-4-[[2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-ethylsulfanyl-1,3-thiazol-5-one |
| SMILES | CCSC1=N/C(=C/c2ccccc2OCc2ccccc2Cl)C(=O)S1 |
| InChI | InChI=1S/C19H16ClNO2S2/c1-2-24-19-21-16(18(22)25-19)11-13-7-4-6-10-17(13)23-12-14-8-3-5-9-15(14)20/h3-11H,2,12H2,1H3/b16-11+ |
| InChIKey | XKDZMJNTGLWFCV-LFIBNONCSA-N |
| XLogP | 5.64 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|