C12H10ClNO2S — CID 56692759
(4Z)-4-[(2-chlorophenyl)methylidene]-2-ethoxy-1,3-thiazol-5-one (PubChem CID 56692759) has the molecular formula C12H10ClNO2S and a molecular weight of 267.74 g/mol. Its IUPAC name is (4Z)-4-[(2-chlorophenyl)methylidene]-2-ethoxy-1,3-thiazol-5-one.
| Compound Name | (4Z)-4-[(2-chlorophenyl)methylidene]-2-ethoxy-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 56692759 |
| Molecular Formula | C12H10ClNO2S |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | (4Z)-4-[(2-chlorophenyl)methylidene]-2-ethoxy-1,3-thiazol-5-one |
| SMILES | CCOC1=N/C(=C\c2ccccc2Cl)C(=O)S1 |
| InChI | InChI=1S/C12H10ClNO2S/c1-2-16-12-14-10(11(15)17-12)7-8-5-3-4-6-9(8)13/h3-7H,2H2,1H3/b10-7- |
| InChIKey | NISFQMGQRWNEOS-YFHOEESVSA-N |
| XLogP | 3.35 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|