C14H15ClN2O — CID 136893880
(4Z)-4-[(2-chlorophenyl)methylidene]-2-(2-methylpropyl)-1H-imidazol-5-one (PubChem CID 136893880) has the molecular formula C14H15ClN2O and a molecular weight of 262.74 g/mol. Its IUPAC name is (4Z)-4-[(2-chlorophenyl)methylidene]-2-(2-methylpropyl)-1H-imidazol-5-one.
| Compound Name | (4Z)-4-[(2-chlorophenyl)methylidene]-2-(2-methylpropyl)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136893880 |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | (4Z)-4-[(2-chlorophenyl)methylidene]-2-(2-methylpropyl)-1H-imidazol-5-one |
| SMILES | CC(C)CC1=N/C(=C\c2ccccc2Cl)C(=O)N1 |
| InChI | InChI=1S/C14H15ClN2O/c1-9(2)7-13-16-12(14(18)17-13)8-10-5-3-4-6-11(10)15/h3-6,8-9H,7H2,1-2H3,(H,16,17,18)/b12-8- |
| InChIKey | AEQJLYPZVQXADI-WQLSENKSSA-N |
| XLogP | 3.26 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|