C17H12ClFN2O — CID 136893587
(4Z)-2-[(4-chlorophenyl)methyl]-4-[(2-fluorophenyl)methylidene]-1H-imidazol-5-one (PubChem CID 136893587) has the molecular formula C17H12ClFN2O and a molecular weight of 314.75 g/mol. Its IUPAC name is (4Z)-2-[(4-chlorophenyl)methyl]-4-[(2-fluorophenyl)methylidene]-1H-imidazol-5-one.
| Compound Name | (4Z)-2-[(4-chlorophenyl)methyl]-4-[(2-fluorophenyl)methylidene]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136893587 |
| Molecular Formula | C17H12ClFN2O |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (4Z)-2-[(4-chlorophenyl)methyl]-4-[(2-fluorophenyl)methylidene]-1H-imidazol-5-one |
| SMILES | O=C1NC(Cc2ccc(Cl)cc2)=N/C1=C\c1ccccc1F |
| InChI | InChI=1S/C17H12ClFN2O/c18-13-7-5-11(6-8-13)9-16-20-15(17(22)21-16)10-12-3-1-2-4-14(12)19/h1-8,10H,9H2,(H,20,21,22)/b15-10- |
| InChIKey | CXNJCXCMFAGSFC-GDNBJRDFSA-N |
| XLogP | 3.59 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|