C19H17FN2O3 — CID 136894476
(4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-[(4-fluorophenyl)methyl]-1H-imidazol-5-one (PubChem CID 136894476) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-[(4-fluorophenyl)methyl]-1H-imidazol-5-one.
| Compound Name | (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-[(4-fluorophenyl)methyl]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136894476 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-[(4-fluorophenyl)methyl]-1H-imidazol-5-one |
| SMILES | COc1ccc(OC)c(/C=C2\N=C(Cc3ccc(F)cc3)NC2=O)c1 |
| InChI | InChI=1S/C19H17FN2O3/c1-24-15-7-8-17(25-2)13(10-15)11-16-19(23)22-18(21-16)9-12-3-5-14(20)6-4-12/h3-8,10-11H,9H2,1-2H3,(H,21,22,23)/b16-11- |
| InChIKey | YTBNNSROXZCPQE-WJDWOHSUSA-N |
| XLogP | 2.95 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|