C17H16N2O3S — CID 136893159
(4E)-2-[(3,4-dimethoxyphenyl)methyl]-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one (PubChem CID 136893159) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is (4E)-2-[(3,4-dimethoxyphenyl)methyl]-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one.
| Compound Name | (4E)-2-[(3,4-dimethoxyphenyl)methyl]-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136893159 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (4E)-2-[(3,4-dimethoxyphenyl)methyl]-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one |
| SMILES | COc1ccc(CC2=N/C(=C/c3cccs3)C(=O)N2)cc1OC |
| InChI | InChI=1S/C17H16N2O3S/c1-21-14-6-5-11(8-15(14)22-2)9-16-18-13(17(20)19-16)10-12-4-3-7-23-12/h3-8,10H,9H2,1-2H3,(H,18,19,20)/b13-10+ |
| InChIKey | PFXMQLGTHLZMCN-JLHYYAGUSA-N |
| XLogP | 2.88 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|