C19H15N3O4S2 — CID 3831592
6-[(3,4-dimethoxyphenyl)methyl]-2-(thiophen-2-ylmethylidene)-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione (PubChem CID 3831592) has the molecular formula C19H15N3O4S2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 6-[(3,4-dimethoxyphenyl)methyl]-2-(thiophen-2-ylmethylidene)-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione.
| Compound Name | 6-[(3,4-dimethoxyphenyl)methyl]-2-(thiophen-2-ylmethylidene)-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione |
|---|---|
| PubChem CID | 3831592 |
| Molecular Formula | C19H15N3O4S2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 6-[(3,4-dimethoxyphenyl)methyl]-2-(thiophen-2-ylmethylidene)-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione |
| SMILES | COc1ccc(Cc2nn3c(=O)c(=Cc4cccs4)sc3nc2=O)cc1OC |
| InChI | InChI=1S/C19H15N3O4S2/c1-25-14-6-5-11(9-15(14)26-2)8-13-17(23)20-19-22(21-13)18(24)16(28-19)10-12-4-3-7-27-12/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | ISUICANQVSRVNE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_H(5)', 'substructure': 'N/A'} |
|---|