C17H11N3O2S2 — CID 1184343
6-benzyl-2-(thiophen-2-ylmethylidene)-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione (PubChem CID 1184343) has the molecular formula C17H11N3O2S2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 6-benzyl-2-(thiophen-2-ylmethylidene)-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione.
| Compound Name | 6-benzyl-2-(thiophen-2-ylmethylidene)-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione |
|---|---|
| PubChem CID | 1184343 |
| Molecular Formula | C17H11N3O2S2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 6-benzyl-2-(thiophen-2-ylmethylidene)-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione |
| SMILES | O=c1nc2sc(=Cc3cccs3)c(=O)n2nc1Cc1ccccc1 |
| InChI | InChI=1S/C17H11N3O2S2/c21-15-13(9-11-5-2-1-3-6-11)19-20-16(22)14(24-17(20)18-15)10-12-7-4-8-23-12/h1-8,10H,9H2 |
| InChIKey | OAUPIAOJIOIUHP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 64.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_H(5)', 'substructure': 'N/A'} |
|---|