C17H13ClN2O — CID 136893375
(4E)-4-benzylidene-2-[(4-chlorophenyl)methyl]-1H-imidazol-5-one (PubChem CID 136893375) has the molecular formula C17H13ClN2O and a molecular weight of 296.76 g/mol. Its IUPAC name is (4E)-4-benzylidene-2-[(4-chlorophenyl)methyl]-1H-imidazol-5-one.
| Compound Name | (4E)-4-benzylidene-2-[(4-chlorophenyl)methyl]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136893375 |
| Molecular Formula | C17H13ClN2O |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | (4E)-4-benzylidene-2-[(4-chlorophenyl)methyl]-1H-imidazol-5-one |
| SMILES | O=C1NC(Cc2ccc(Cl)cc2)=N/C1=C/c1ccccc1 |
| InChI | InChI=1S/C17H13ClN2O/c18-14-8-6-13(7-9-14)11-16-19-15(17(21)20-16)10-12-4-2-1-3-5-12/h1-10H,11H2,(H,19,20,21)/b15-10+ |
| InChIKey | CCYLGXJCAJXRGJ-XNTDXEJSSA-N |
| XLogP | 3.45 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|