C17H14ClN3O — CID 136893335
(4E)-2-[2-(4-chlorophenyl)ethyl]-4-(pyridin-4-ylmethylidene)-1H-imidazol-5-one (PubChem CID 136893335) has the molecular formula C17H14ClN3O and a molecular weight of 311.77 g/mol. Its IUPAC name is (4E)-2-[2-(4-chlorophenyl)ethyl]-4-(pyridin-4-ylmethylidene)-1H-imidazol-5-one.
| Compound Name | (4E)-2-[2-(4-chlorophenyl)ethyl]-4-(pyridin-4-ylmethylidene)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136893335 |
| Molecular Formula | C17H14ClN3O |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (4E)-2-[2-(4-chlorophenyl)ethyl]-4-(pyridin-4-ylmethylidene)-1H-imidazol-5-one |
| SMILES | O=C1NC(CCc2ccc(Cl)cc2)=N/C1=C/c1ccncc1 |
| InChI | InChI=1S/C17H14ClN3O/c18-14-4-1-12(2-5-14)3-6-16-20-15(17(22)21-16)11-13-7-9-19-10-8-13/h1-2,4-5,7-11H,3,6H2,(H,20,21,22)/b15-11+ |
| InChIKey | FXUUIHLIBBKVRQ-RVDMUPIBSA-N |
| XLogP | 3.24 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|