C19H16Cl2N2O2 — CID 136895339
(4E)-4-[(3,4-dichlorophenyl)methylidene]-2-[2-(4-methoxyphenyl)ethyl]-1H-imidazol-5-one (PubChem CID 136895339) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is (4E)-4-[(3,4-dichlorophenyl)methylidene]-2-[2-(4-methoxyphenyl)ethyl]-1H-imidazol-5-one.
| Compound Name | (4E)-4-[(3,4-dichlorophenyl)methylidene]-2-[2-(4-methoxyphenyl)ethyl]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136895339 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (4E)-4-[(3,4-dichlorophenyl)methylidene]-2-[2-(4-methoxyphenyl)ethyl]-1H-imidazol-5-one |
| SMILES | COc1ccc(CCC2=N/C(=C/c3ccc(Cl)c(Cl)c3)C(=O)N2)cc1 |
| InChI | InChI=1S/C19H16Cl2N2O2/c1-25-14-6-2-12(3-7-14)5-9-18-22-17(19(24)23-18)11-13-4-8-15(20)16(21)10-13/h2-4,6-8,10-11H,5,9H2,1H3,(H,22,23,24)/b17-11+ |
| InChIKey | MDKHYPYRDYIIFB-GZTJUZNOSA-N |
| XLogP | 4.50 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|