C17H22N2O3 — CID 136894868
(4E)-4-[(2,5-dimethoxy-4-methylphenyl)methylidene]-2-(2-methylpropyl)-1H-imidazol-5-one (PubChem CID 136894868) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is (4E)-4-[(2,5-dimethoxy-4-methylphenyl)methylidene]-2-(2-methylpropyl)-1H-imidazol-5-one.
| Compound Name | (4E)-4-[(2,5-dimethoxy-4-methylphenyl)methylidene]-2-(2-methylpropyl)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136894868 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (4E)-4-[(2,5-dimethoxy-4-methylphenyl)methylidene]-2-(2-methylpropyl)-1H-imidazol-5-one |
| SMILES | COc1cc(/C=C2/N=C(CC(C)C)NC2=O)c(OC)cc1C |
| InChI | InChI=1S/C17H22N2O3/c1-10(2)6-16-18-13(17(20)19-16)8-12-9-14(21-4)11(3)7-15(12)22-5/h7-10H,6H2,1-5H3,(H,18,19,20)/b13-8+ |
| InChIKey | MFFYIQGWMWVMLR-MDWZMJQESA-N |
| XLogP | 2.93 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|