C21H21ClN2O3 — CID 136894907
(4E)-2-[2-(2-chlorophenyl)ethyl]-4-[(2,5-dimethoxy-4-methylphenyl)methylidene]-1H-imidazol-5-one (PubChem CID 136894907) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is (4E)-2-[2-(2-chlorophenyl)ethyl]-4-[(2,5-dimethoxy-4-methylphenyl)methylidene]-1H-imidazol-5-one.
| Compound Name | (4E)-2-[2-(2-chlorophenyl)ethyl]-4-[(2,5-dimethoxy-4-methylphenyl)methylidene]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136894907 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (4E)-2-[2-(2-chlorophenyl)ethyl]-4-[(2,5-dimethoxy-4-methylphenyl)methylidene]-1H-imidazol-5-one |
| SMILES | COc1cc(/C=C2/N=C(CCc3ccccc3Cl)NC2=O)c(OC)cc1C |
| InChI | InChI=1S/C21H21ClN2O3/c1-13-10-19(27-3)15(12-18(13)26-2)11-17-21(25)24-20(23-17)9-8-14-6-4-5-7-16(14)22/h4-7,10-12H,8-9H2,1-3H3,(H,23,24,25)/b17-11+ |
| InChIKey | DSWYARLMQOMILO-GZTJUZNOSA-N |
| XLogP | 4.17 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|