C17H15ClN2O3 — CID 136895492
(4E)-4-[(5-chloro-2-methoxyphenyl)methylidene]-2-[2-(furan-2-yl)ethyl]-1H-imidazol-5-one (PubChem CID 136895492) has the molecular formula C17H15ClN2O3 and a molecular weight of 330.77 g/mol. Its IUPAC name is (4E)-4-[(5-chloro-2-methoxyphenyl)methylidene]-2-[2-(furan-2-yl)ethyl]-1H-imidazol-5-one.
| Compound Name | (4E)-4-[(5-chloro-2-methoxyphenyl)methylidene]-2-[2-(furan-2-yl)ethyl]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136895492 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | (4E)-4-[(5-chloro-2-methoxyphenyl)methylidene]-2-[2-(furan-2-yl)ethyl]-1H-imidazol-5-one |
| SMILES | COc1ccc(Cl)cc1/C=C1/N=C(CCc2ccco2)NC1=O |
| InChI | InChI=1S/C17H15ClN2O3/c1-22-15-6-4-12(18)9-11(15)10-14-17(21)20-16(19-14)7-5-13-3-2-8-23-13/h2-4,6,8-10H,5,7H2,1H3,(H,19,20,21)/b14-10+ |
| InChIKey | QWZSCDCGPGXSSP-GXDHUFHOSA-N |
| XLogP | 3.44 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|