C16H14N2O3 — CID 136895408
(4E)-2-(furan-2-yl)-4-[(2-methoxy-5-methylphenyl)methylidene]-1H-imidazol-5-one (PubChem CID 136895408) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is (4E)-2-(furan-2-yl)-4-[(2-methoxy-5-methylphenyl)methylidene]-1H-imidazol-5-one.
| Compound Name | (4E)-2-(furan-2-yl)-4-[(2-methoxy-5-methylphenyl)methylidene]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136895408 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (4E)-2-(furan-2-yl)-4-[(2-methoxy-5-methylphenyl)methylidene]-1H-imidazol-5-one |
| SMILES | COc1ccc(C)cc1/C=C1/N=C(c2ccco2)NC1=O |
| InChI | InChI=1S/C16H14N2O3/c1-10-5-6-13(20-2)11(8-10)9-12-16(19)18-15(17-12)14-4-3-7-21-14/h3-9H,1-2H3,(H,17,18,19)/b12-9+ |
| InChIKey | JBUSEZOVWGLQHK-FMIVXFBMSA-N |
| XLogP | 2.51 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|