C14H9ClN2O2 — CID 136893883
(4Z)-4-[(2-chlorophenyl)methylidene]-2-(furan-2-yl)-1H-imidazol-5-one (PubChem CID 136893883) has the molecular formula C14H9ClN2O2 and a molecular weight of 272.69 g/mol. Its IUPAC name is (4Z)-4-[(2-chlorophenyl)methylidene]-2-(furan-2-yl)-1H-imidazol-5-one.
| Compound Name | (4Z)-4-[(2-chlorophenyl)methylidene]-2-(furan-2-yl)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136893883 |
| Molecular Formula | C14H9ClN2O2 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | (4Z)-4-[(2-chlorophenyl)methylidene]-2-(furan-2-yl)-1H-imidazol-5-one |
| SMILES | O=C1NC(c2ccco2)=N/C1=C\c1ccccc1Cl |
| InChI | InChI=1S/C14H9ClN2O2/c15-10-5-2-1-4-9(10)8-11-14(18)17-13(16-11)12-6-3-7-19-12/h1-8H,(H,16,17,18)/b11-8- |
| InChIKey | PCRBPHNNLFNTBL-FLIBITNWSA-N |
| XLogP | 2.85 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|