C14H8Cl2N2O2 — CID 135519731
2-(2,4-dichlorophenyl)-4-(furan-2-ylmethylidene)-1H-imidazol-5-one (PubChem CID 135519731) has the molecular formula C14H8Cl2N2O2 and a molecular weight of 307.14 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-4-(furan-2-ylmethylidene)-1H-imidazol-5-one.
| Compound Name | 2-(2,4-dichlorophenyl)-4-(furan-2-ylmethylidene)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 135519731 |
| Molecular Formula | C14H8Cl2N2O2 |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-4-(furan-2-ylmethylidene)-1H-imidazol-5-one |
| SMILES | O=C1NC(c2ccc(Cl)cc2Cl)=NC1=Cc1ccco1 |
| InChI | InChI=1S/C14H8Cl2N2O2/c15-8-3-4-10(11(16)6-8)13-17-12(14(19)18-13)7-9-2-1-5-20-9/h1-7H,(H,17,18,19) |
| InChIKey | UROZNWQJLRXCRB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|